C17H18N2O6S — CID 33479245
[2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 2,5-dimethylthiophene-3-carboxylate (PubChem CID 33479245) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is [2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 2,5-dimethylthiophene-3-carboxylate.
| Compound Name | [2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 2,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 33479245 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 2,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2cc(C)sc2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18N2O6S/c1-4-24-12-5-6-14(15(8-12)19(22)23)18-16(20)9-25-17(21)13-7-10(2)26-11(13)3/h5-8H,4,9H2,1-3H3,(H,18,20) |
| InChIKey | XUXSHZFWGDZMCQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|