C22H26N4O8 — CID 5235455
N,N'-bis(4-ethoxy-2-nitrophenyl)hexanediamide (PubChem CID 5235455) has the molecular formula C22H26N4O8 and a molecular weight of 474.47 g/mol. Its IUPAC name is N,N'-bis(4-ethoxy-2-nitrophenyl)hexanediamide.
| Compound Name | N,N'-bis(4-ethoxy-2-nitrophenyl)hexanediamide |
|---|---|
| PubChem CID | 5235455 |
| Molecular Formula | C22H26N4O8 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N,N'-bis(4-ethoxy-2-nitrophenyl)hexanediamide |
| SMILES | CCOc1ccc(NC(=O)CCCCC(=O)Nc2ccc(OCC)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H26N4O8/c1-3-33-15-9-11-17(19(13-15)25(29)30)23-21(27)7-5-6-8-22(28)24-18-12-10-16(34-4-2)14-20(18)26(31)32/h9-14H,3-8H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | LKHDZDLQQYWLAT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|