C16H23N3O6 — CID 18886251
2-(diethylamino)-4-(4-ethoxy-2-nitroanilino)-4-oxobutanoic acid (PubChem CID 18886251) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-(diethylamino)-4-(4-ethoxy-2-nitroanilino)-4-oxobutanoic acid.
| Compound Name | 2-(diethylamino)-4-(4-ethoxy-2-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18886251 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-(diethylamino)-4-(4-ethoxy-2-nitroanilino)-4-oxobutanoic acid |
| SMILES | CCOc1ccc(NC(=O)CC(C(=O)O)N(CC)CC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H23N3O6/c1-4-18(5-2)14(16(21)22)10-15(20)17-12-8-7-11(25-6-3)9-13(12)19(23)24/h7-9,14H,4-6,10H2,1-3H3,(H,17,20)(H,21,22) |
| InChIKey | QLIXGKIPAVMTJK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|