C23H38N4O6 — CID 95091696
(2R)-2-[5-[di(propan-2-yl)amino]pentylamino]-4-(4-ethoxy-2-nitroanilino)-4-oxobutanoic acid (PubChem CID 95091696) has the molecular formula C23H38N4O6 and a molecular weight of 466.58 g/mol. Its IUPAC name is (2R)-2-[5-[di(propan-2-yl)amino]pentylamino]-4-(4-ethoxy-2-nitroanilino)-4-oxobutanoic acid.
| Compound Name | (2R)-2-[5-[di(propan-2-yl)amino]pentylamino]-4-(4-ethoxy-2-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 95091696 |
| Molecular Formula | C23H38N4O6 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (2R)-2-[5-[di(propan-2-yl)amino]pentylamino]-4-(4-ethoxy-2-nitroanilino)-4-oxobutanoic acid |
| SMILES | CCOc1ccc(NC(=O)C[C@@H](NCCCCCN(C(C)C)C(C)C)C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H38N4O6/c1-6-33-18-10-11-19(21(14-18)27(31)32)25-22(28)15-20(23(29)30)24-12-8-7-9-13-26(16(2)3)17(4)5/h10-11,14,16-17,20,24H,6-9,12-13,15H2,1-5H3,(H,25,28)(H,29,30)/t20-/m1/s1 |
| InChIKey | MYWXZYYCGMYAHM-HXUWFJFHSA-N |
| XLogP | 3.65 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|