C16H23N3O5 — CID 18858600
2-(3-methylbutylamino)-4-(4-methyl-2-nitroanilino)-4-oxobutanoic acid (PubChem CID 18858600) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-(3-methylbutylamino)-4-(4-methyl-2-nitroanilino)-4-oxobutanoic acid.
| Compound Name | 2-(3-methylbutylamino)-4-(4-methyl-2-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18858600 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-(3-methylbutylamino)-4-(4-methyl-2-nitroanilino)-4-oxobutanoic acid |
| SMILES | Cc1ccc(NC(=O)CC(NCCC(C)C)C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H23N3O5/c1-10(2)6-7-17-13(16(21)22)9-15(20)18-12-5-4-11(3)8-14(12)19(23)24/h4-5,8,10,13,17H,6-7,9H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | PAMFTMGTFKIRKQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|