C15H21N3O7 — CID 7592630
(2R)-4-(4-ethoxy-2-nitroanilino)-2-[[(2R)-2-hydroxypropyl]amino]-4-oxobutanoic acid (PubChem CID 7592630) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is (2R)-4-(4-ethoxy-2-nitroanilino)-2-[[(2R)-2-hydroxypropyl]amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(4-ethoxy-2-nitroanilino)-2-[[(2R)-2-hydroxypropyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7592630 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (2R)-4-(4-ethoxy-2-nitroanilino)-2-[[(2R)-2-hydroxypropyl]amino]-4-oxobutanoic acid |
| SMILES | CCOc1ccc(NC(=O)C[C@@H](NC[C@@H](C)O)C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H21N3O7/c1-3-25-10-4-5-11(13(6-10)18(23)24)17-14(20)7-12(15(21)22)16-8-9(2)19/h4-6,9,12,16,19H,3,7-8H2,1-2H3,(H,17,20)(H,21,22)/t9-,12-/m1/s1 |
| InChIKey | XCMOIWYHJHVFFS-BXKDBHETSA-N |
| XLogP | 0.75 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|