C13H16ClN3O6 — CID 18858499
4-(2-chloro-5-nitroanilino)-2-(2-hydroxypropylamino)-4-oxobutanoic acid (PubChem CID 18858499) has the molecular formula C13H16ClN3O6 and a molecular weight of 345.74 g/mol. Its IUPAC name is 4-(2-chloro-5-nitroanilino)-2-(2-hydroxypropylamino)-4-oxobutanoic acid.
| Compound Name | 4-(2-chloro-5-nitroanilino)-2-(2-hydroxypropylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18858499 |
| Molecular Formula | C13H16ClN3O6 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 4-(2-chloro-5-nitroanilino)-2-(2-hydroxypropylamino)-4-oxobutanoic acid |
| SMILES | CC(O)CNC(CC(=O)Nc1cc([N+](=O)[O-])ccc1Cl)C(=O)O |
| InChI | InChI=1S/C13H16ClN3O6/c1-7(18)6-15-11(13(20)21)5-12(19)16-10-4-8(17(22)23)2-3-9(10)14/h2-4,7,11,15,18H,5-6H2,1H3,(H,16,19)(H,20,21) |
| InChIKey | ZOJJNHGGGCRLQX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|