C21H26N2O7 — CID 2862752
3,4,5-triethoxy-N-(4-ethoxy-2-nitrophenyl)benzamide (PubChem CID 2862752) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(4-ethoxy-2-nitrophenyl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(4-ethoxy-2-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 2862752 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 3,4,5-triethoxy-N-(4-ethoxy-2-nitrophenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(OCC)c(OCC)c(OCC)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N2O7/c1-5-27-15-9-10-16(17(13-15)23(25)26)22-21(24)14-11-18(28-6-2)20(30-8-4)19(12-14)29-7-3/h9-13H,5-8H2,1-4H3,(H,22,24) |
| InChIKey | RJJAITSYEQQGPW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|