C13H10Cl2N2O4S — CID 3143002
2,5-dichloro-N-(4-ethoxy-2-nitrophenyl)thiophene-3-carboxamide (PubChem CID 3143002) has the molecular formula C13H10Cl2N2O4S and a molecular weight of 361.21 g/mol. Its IUPAC name is 2,5-dichloro-N-(4-ethoxy-2-nitrophenyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(4-ethoxy-2-nitrophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 3143002 |
| Molecular Formula | C13H10Cl2N2O4S |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 2,5-dichloro-N-(4-ethoxy-2-nitrophenyl)thiophene-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(Cl)sc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10Cl2N2O4S/c1-2-21-7-3-4-9(10(5-7)17(19)20)16-13(18)8-6-11(14)22-12(8)15/h3-6H,2H2,1H3,(H,16,18) |
| InChIKey | GXDWOJVPFYNUPD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|