C23H21N5O8 — CID 4079901
2-N,6-N-bis(4-ethoxy-2-nitrophenyl)pyridine-2,6-dicarboxamide (PubChem CID 4079901) has the molecular formula C23H21N5O8 and a molecular weight of 495.45 g/mol. Its IUPAC name is 2-N,6-N-bis(4-ethoxy-2-nitrophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(4-ethoxy-2-nitrophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 4079901 |
| Molecular Formula | C23H21N5O8 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-N,6-N-bis(4-ethoxy-2-nitrophenyl)pyridine-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cccc(C(=O)Nc3ccc(OCC)cc3[N+](=O)[O-])n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21N5O8/c1-3-35-14-8-10-16(20(12-14)27(31)32)25-22(29)18-6-5-7-19(24-18)23(30)26-17-11-9-15(36-4-2)13-21(17)28(33)34/h5-13H,3-4H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | ZGGWDVGUEONMIE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|