C21H17N5O8 — CID 3620305
2-N,6-N-bis(4-methoxy-2-nitrophenyl)pyridine-2,6-dicarboxamide (PubChem CID 3620305) has the molecular formula C21H17N5O8 and a molecular weight of 467.39 g/mol. Its IUPAC name is 2-N,6-N-bis(4-methoxy-2-nitrophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(4-methoxy-2-nitrophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 3620305 |
| Molecular Formula | C21H17N5O8 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-N,6-N-bis(4-methoxy-2-nitrophenyl)pyridine-2,6-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2cccc(C(=O)Nc3ccc(OC)cc3[N+](=O)[O-])n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17N5O8/c1-33-12-6-8-14(18(10-12)25(29)30)23-20(27)16-4-3-5-17(22-16)21(28)24-15-9-7-13(34-2)11-19(15)26(31)32/h3-11H,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | NULRCLAZPYDSCA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|