6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid

C13H8N4O7 — CID 102437083

IUPAC6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(C(=O)Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])n1
InChIInChI=1S/C13H8N4O7/c18-12(9-2-1-3-10(14-9)13(19)20)15-8-5-4-7(16(21)22)6-11(8)17(23)24/h1-6H,(H,15,18)(H,19,20)
InChIKeyMKGKLPCNVIRBPS-UHFFFAOYSA-N
MW332.23 g/mol
LogP1.85
Rot. Bonds5

About 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid

6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid (PubChem CID 102437083) has the molecular formula C13H8N4O7 and a molecular weight of 332.23 g/mol. Its IUPAC name is 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid
PubChem CID102437083
Molecular FormulaC13H8N4O7
Molecular Weight332.23 g/mol
Exact Mass332.04
IUPAC Name6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(C(=O)Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])n1
InChIInChI=1S/C13H8N4O7/c18-12(9-2-1-3-10(14-9)13(19)20)15-8-5-4-7(16(21)22)6-11(8)17(23)24/h1-6H,(H,15,18)(H,19,20)
InChIKeyMKGKLPCNVIRBPS-UHFFFAOYSA-N
XLogP1.85
TPSA165.57 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.23
LogP ≤ 51.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid?
The IUPAC name of 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid (CID 102437083) is 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid is O=C(O)c1cccc(C(=O)Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])n1.
What is the InChIKey of 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid?
The InChIKey is MKGKLPCNVIRBPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4O7/c18-12(9-2-1-3-10(14-9)13(19)20)15-8-5-4-7(16(21)22)6-11(8)17(23)24/h1-6H,(H,15,18)(H,19,20).
What are the key properties of 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid?
6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid has a molecular weight of 332.23 g/mol, XLogP of 1.85, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 102437083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).