C13H8N4O7 — CID 102437083
6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid (PubChem CID 102437083) has the molecular formula C13H8N4O7 and a molecular weight of 332.23 g/mol. Its IUPAC name is 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 102437083 |
| Molecular Formula | C13H8N4O7 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 6-[(2,4-dinitrophenyl)carbamoyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(C(=O)Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H8N4O7/c18-12(9-2-1-3-10(14-9)13(19)20)15-8-5-4-7(16(21)22)6-11(8)17(23)24/h1-6H,(H,15,18)(H,19,20) |
| InChIKey | MKGKLPCNVIRBPS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 165.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|