C20H12N6O10 — CID 628714
1-N,3-N-bis(2,4-dinitrophenyl)benzene-1,3-dicarboxamide (PubChem CID 628714) has the molecular formula C20H12N6O10 and a molecular weight of 496.35 g/mol. Its IUPAC name is 1-N,3-N-bis(2,4-dinitrophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,4-dinitrophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 628714 |
| Molecular Formula | C20H12N6O10 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 1-N,3-N-bis(2,4-dinitrophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1cccc(C(=O)Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H12N6O10/c27-19(21-15-6-4-13(23(29)30)9-17(15)25(33)34)11-2-1-3-12(8-11)20(28)22-16-7-5-14(24(31)32)10-18(16)26(35)36/h1-10H,(H,21,27)(H,22,28) |
| InChIKey | BGNMLOMACRZRAS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 230.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|