C21H16N4O6 — CID 5152612
N-[4-[(2,4-dinitrophenyl)carbamoyl]phenyl]-3-methylbenzamide (PubChem CID 5152612) has the molecular formula C21H16N4O6 and a molecular weight of 420.38 g/mol. Its IUPAC name is N-[4-[(2,4-dinitrophenyl)carbamoyl]phenyl]-3-methylbenzamide.
| Compound Name | N-[4-[(2,4-dinitrophenyl)carbamoyl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 5152612 |
| Molecular Formula | C21H16N4O6 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[4-[(2,4-dinitrophenyl)carbamoyl]phenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C21H16N4O6/c1-13-3-2-4-15(11-13)21(27)22-16-7-5-14(6-8-16)20(26)23-18-10-9-17(24(28)29)12-19(18)25(30)31/h2-12H,1H3,(H,22,27)(H,23,26) |
| InChIKey | VNSDDMLFYXGVNQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|