C23H20N4O4 — CID 3328905
3-methyl-N-[4-[[1-(4-nitrophenyl)ethylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 3328905) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 3-methyl-N-[4-[[1-(4-nitrophenyl)ethylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[[1-(4-nitrophenyl)ethylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3328905 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 3-methyl-N-[4-[[1-(4-nitrophenyl)ethylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(NC(=O)c2cccc(C)c2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H20N4O4/c1-15-4-3-5-19(14-15)22(28)24-20-10-6-18(7-11-20)23(29)26-25-16(2)17-8-12-21(13-9-17)27(30)31/h3-14H,1-2H3,(H,24,28)(H,26,29) |
| InChIKey | XGNOGOHUGICJQC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|