C21H19N3O2S — CID 3329054
3-methyl-N-[4-[(1-thiophen-2-ylethylideneamino)carbamoyl]phenyl]benzamide (PubChem CID 3329054) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 3-methyl-N-[4-[(1-thiophen-2-ylethylideneamino)carbamoyl]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[(1-thiophen-2-ylethylideneamino)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3329054 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-methyl-N-[4-[(1-thiophen-2-ylethylideneamino)carbamoyl]phenyl]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(NC(=O)c2cccc(C)c2)cc1)c1cccs1 |
| InChI | InChI=1S/C21H19N3O2S/c1-14-5-3-6-17(13-14)20(25)22-18-10-8-16(9-11-18)21(26)24-23-15(2)19-7-4-12-27-19/h3-13H,1-2H3,(H,22,25)(H,24,26) |
| InChIKey | YLHFQPHDUSNECH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|