C20H16N4O5 — CID 3098044
3-(2,4-dinitroanilino)-N-(2-methylphenyl)benzamide (PubChem CID 3098044) has the molecular formula C20H16N4O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is 3-(2,4-dinitroanilino)-N-(2-methylphenyl)benzamide.
| Compound Name | 3-(2,4-dinitroanilino)-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 3098044 |
| Molecular Formula | C20H16N4O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-(2,4-dinitroanilino)-N-(2-methylphenyl)benzamide |
| SMILES | Cc1ccccc1NC(=O)c1cccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16N4O5/c1-13-5-2-3-8-17(13)22-20(25)14-6-4-7-15(11-14)21-18-10-9-16(23(26)27)12-19(18)24(28)29/h2-12,21H,1H3,(H,22,25) |
| InChIKey | RYNTUUALZWVOAF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|