C19H16ClN5O3 — CID 108792492
N-(2-chloro-4-nitrophenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide (PubChem CID 108792492) has the molecular formula C19H16ClN5O3 and a molecular weight of 397.82 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 108792492 |
| Molecular Formula | C19H16ClN5O3 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide |
| SMILES | Cc1cc(C)nc(Nc2cccc(C(=O)Nc3ccc([N+](=O)[O-])cc3Cl)c2)n1 |
| InChI | InChI=1S/C19H16ClN5O3/c1-11-8-12(2)22-19(21-11)23-14-5-3-4-13(9-14)18(26)24-17-7-6-15(25(27)28)10-16(17)20/h3-10H,1-2H3,(H,24,26)(H,21,22,23) |
| InChIKey | HUXCRLJVPFKBKQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|