C14H12N4O5 — CID 170860355
2-amino-1-[3-(2,4-dinitroanilino)phenyl]ethanone (PubChem CID 170860355) has the molecular formula C14H12N4O5 and a molecular weight of 316.27 g/mol. Its IUPAC name is 2-amino-1-[3-(2,4-dinitroanilino)phenyl]ethanone.
| Compound Name | 2-amino-1-[3-(2,4-dinitroanilino)phenyl]ethanone |
|---|---|
| PubChem CID | 170860355 |
| Molecular Formula | C14H12N4O5 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-amino-1-[3-(2,4-dinitroanilino)phenyl]ethanone |
| SMILES | NCC(=O)c1cccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N4O5/c15-8-14(19)9-2-1-3-10(6-9)16-12-5-4-11(17(20)21)7-13(12)18(22)23/h1-7,16H,8,15H2 |
| InChIKey | AJKRCLPMFHOMCH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|