C7H8N4O4 — CID 23597616
N'-(2,4-dinitrophenyl)methanediamine (PubChem CID 23597616) has the molecular formula C7H8N4O4 and a molecular weight of 212.17 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)methanediamine.
| Compound Name | N'-(2,4-dinitrophenyl)methanediamine |
|---|---|
| PubChem CID | 23597616 |
| Molecular Formula | C7H8N4O4 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | N'-(2,4-dinitrophenyl)methanediamine |
| SMILES | NCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8N4O4/c8-4-9-6-2-1-5(10(12)13)3-7(6)11(14)15/h1-3,9H,4,8H2 |
| InChIKey | GERZRVZMJCASMR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|