C11H11N3O4 — CID 103704472
2,4-dinitro-N-pent-4-ynylaniline (PubChem CID 103704472) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 2,4-dinitro-N-pent-4-ynylaniline.
| Compound Name | 2,4-dinitro-N-pent-4-ynylaniline |
|---|---|
| PubChem CID | 103704472 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2,4-dinitro-N-pent-4-ynylaniline |
| SMILES | C#CCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N3O4/c1-2-3-4-7-12-10-6-5-9(13(15)16)8-11(10)14(17)18/h1,5-6,8,12H,3-4,7H2 |
| InChIKey | TZIKWIHPIPVEKE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|