C11H15N3O4S — CID 115637405
N-(4-methylsulfanylbutyl)-2,4-dinitroaniline (PubChem CID 115637405) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is N-(4-methylsulfanylbutyl)-2,4-dinitroaniline.
| Compound Name | N-(4-methylsulfanylbutyl)-2,4-dinitroaniline |
|---|---|
| PubChem CID | 115637405 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-(4-methylsulfanylbutyl)-2,4-dinitroaniline |
| SMILES | CSCCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O4S/c1-19-7-3-2-6-12-10-5-4-9(13(15)16)8-11(10)14(17)18/h4-5,8,12H,2-3,6-7H2,1H3 |
| InChIKey | IODZGGWWZFWOQA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|