C10H15N3O4S2 — CID 67226820
4-(3-methylsulfanylpropylamino)-3-nitrobenzenesulfonamide (PubChem CID 67226820) has the molecular formula C10H15N3O4S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(3-methylsulfanylpropylamino)-3-nitrobenzenesulfonamide.
| Compound Name | 4-(3-methylsulfanylpropylamino)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67226820 |
| Molecular Formula | C10H15N3O4S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-(3-methylsulfanylpropylamino)-3-nitrobenzenesulfonamide |
| SMILES | CSCCCNc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O4S2/c1-18-6-2-5-12-9-4-3-8(19(11,16)17)7-10(9)13(14)15/h3-4,7,12H,2,5-6H2,1H3,(H2,11,16,17) |
| InChIKey | ASQNHPLZGRFEHO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|