C10H15ClN2O2S2 — CID 43745778
4-chloro-3-(3-methylsulfanylpropylamino)benzenesulfonamide (PubChem CID 43745778) has the molecular formula C10H15ClN2O2S2 and a molecular weight of 294.83 g/mol. Its IUPAC name is 4-chloro-3-(3-methylsulfanylpropylamino)benzenesulfonamide.
| Compound Name | 4-chloro-3-(3-methylsulfanylpropylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43745778 |
| Molecular Formula | C10H15ClN2O2S2 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 4-chloro-3-(3-methylsulfanylpropylamino)benzenesulfonamide |
| SMILES | CSCCCNc1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C10H15ClN2O2S2/c1-16-6-2-5-13-10-7-8(17(12,14)15)3-4-9(10)11/h3-4,7,13H,2,5-6H2,1H3,(H2,12,14,15) |
| InChIKey | JVAPEYBABNRDDG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|