C15H17ClN2O2S — CID 43791004
4-chloro-3-[(3,4-dimethylphenyl)methylamino]benzenesulfonamide (PubChem CID 43791004) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is 4-chloro-3-[(3,4-dimethylphenyl)methylamino]benzenesulfonamide.
| Compound Name | 4-chloro-3-[(3,4-dimethylphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 43791004 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-chloro-3-[(3,4-dimethylphenyl)methylamino]benzenesulfonamide |
| SMILES | Cc1ccc(CNc2cc(S(N)(=O)=O)ccc2Cl)cc1C |
| InChI | InChI=1S/C15H17ClN2O2S/c1-10-3-4-12(7-11(10)2)9-18-15-8-13(21(17,19)20)5-6-14(15)16/h3-8,18H,9H2,1-2H3,(H2,17,19,20) |
| InChIKey | DAFHMZPQXPSJGA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |