C14H15ClN2O3S — CID 43745796
4-chloro-3-[(4-methoxyphenyl)methylamino]benzenesulfonamide (PubChem CID 43745796) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 4-chloro-3-[(4-methoxyphenyl)methylamino]benzenesulfonamide.
| Compound Name | 4-chloro-3-[(4-methoxyphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 43745796 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-chloro-3-[(4-methoxyphenyl)methylamino]benzenesulfonamide |
| SMILES | COc1ccc(CNc2cc(S(N)(=O)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C14H15ClN2O3S/c1-20-11-4-2-10(3-5-11)9-17-14-8-12(21(16,18)19)6-7-13(14)15/h2-8,17H,9H2,1H3,(H2,16,18,19) |
| InChIKey | HGLKHTVTBIJMFI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |