C8H11ClN2O4S2 — CID 61132365
4-chloro-3-(ethylsulfonylamino)benzenesulfonamide (PubChem CID 61132365) has the molecular formula C8H11ClN2O4S2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 4-chloro-3-(ethylsulfonylamino)benzenesulfonamide.
| Compound Name | 4-chloro-3-(ethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 61132365 |
| Molecular Formula | C8H11ClN2O4S2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 4-chloro-3-(ethylsulfonylamino)benzenesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C8H11ClN2O4S2/c1-2-16(12,13)11-8-5-6(17(10,14)15)3-4-7(8)9/h3-5,11H,2H2,1H3,(H2,10,14,15) |
| InChIKey | IRNJMBRDRXZYKM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |