C8H10ClNO4S2 — CID 54596106
4-chloro-3-ethylsulfonylbenzenesulfonamide (PubChem CID 54596106) has the molecular formula C8H10ClNO4S2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 4-chloro-3-ethylsulfonylbenzenesulfonamide.
| Compound Name | 4-chloro-3-ethylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 54596106 |
| Molecular Formula | C8H10ClNO4S2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | 4-chloro-3-ethylsulfonylbenzenesulfonamide |
| SMILES | CCS(=O)(=O)c1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C8H10ClNO4S2/c1-2-15(11,12)8-5-6(16(10,13)14)3-4-7(8)9/h3-5H,2H2,1H3,(H2,10,13,14) |
| InChIKey | XVQYEOWPATUPPC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |