C15H15ClN2O6S2 — CID 166391621
4-[(2-chloro-5-sulfamoylphenyl)sulfonyl-ethylamino]benzoic acid (PubChem CID 166391621) has the molecular formula C15H15ClN2O6S2 and a molecular weight of 418.88 g/mol. Its IUPAC name is 4-[(2-chloro-5-sulfamoylphenyl)sulfonyl-ethylamino]benzoic acid.
| Compound Name | 4-[(2-chloro-5-sulfamoylphenyl)sulfonyl-ethylamino]benzoic acid |
|---|---|
| PubChem CID | 166391621 |
| Molecular Formula | C15H15ClN2O6S2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 4-[(2-chloro-5-sulfamoylphenyl)sulfonyl-ethylamino]benzoic acid |
| SMILES | CCN(c1ccc(C(=O)O)cc1)S(=O)(=O)c1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C15H15ClN2O6S2/c1-2-18(11-5-3-10(4-6-11)15(19)20)26(23,24)14-9-12(25(17,21)22)7-8-13(14)16/h3-9H,2H2,1H3,(H,19,20)(H2,17,21,22) |
| InChIKey | OXTKNPIJTCKIFP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |