C17H19ClN2O3S — CID 58107394
2-chloro-5-[4-(diethylamino)benzoyl]benzenesulfonamide (PubChem CID 58107394) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is 2-chloro-5-[4-(diethylamino)benzoyl]benzenesulfonamide.
| Compound Name | 2-chloro-5-[4-(diethylamino)benzoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58107394 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-chloro-5-[4-(diethylamino)benzoyl]benzenesulfonamide |
| SMILES | CCN(CC)c1ccc(C(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C17H19ClN2O3S/c1-3-20(4-2)14-8-5-12(6-9-14)17(21)13-7-10-15(18)16(11-13)24(19,22)23/h5-11H,3-4H2,1-2H3,(H2,19,22,23) |
| InChIKey | DMCJIMUUZVGZEK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |