C14H11ClN2O4S — CID 12850058
2-(4-chloro-3-sulfamoylbenzoyl)benzamide (PubChem CID 12850058) has the molecular formula C14H11ClN2O4S and a molecular weight of 338.77 g/mol. Its IUPAC name is 2-(4-chloro-3-sulfamoylbenzoyl)benzamide.
| Compound Name | 2-(4-chloro-3-sulfamoylbenzoyl)benzamide |
|---|---|
| PubChem CID | 12850058 |
| Molecular Formula | C14H11ClN2O4S |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 2-(4-chloro-3-sulfamoylbenzoyl)benzamide |
| SMILES | NC(=O)c1ccccc1C(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H11ClN2O4S/c15-11-6-5-8(7-12(11)22(17,20)21)13(18)9-3-1-2-4-10(9)14(16)19/h1-7H,(H2,16,19)(H2,17,20,21) |
| InChIKey | QMDAJMIPLVXIDQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |