C8H10Cl2N4O3S — CID 19096090
4-chloro-N-(diaminomethylidene)-3-sulfamoylbenzamide;hydrochloride (PubChem CID 19096090) has the molecular formula C8H10Cl2N4O3S and a molecular weight of 313.17 g/mol. Its IUPAC name is 4-chloro-N-(diaminomethylidene)-3-sulfamoylbenzamide;hydrochloride.
| Compound Name | 4-chloro-N-(diaminomethylidene)-3-sulfamoylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 19096090 |
| Molecular Formula | C8H10Cl2N4O3S |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 4-chloro-N-(diaminomethylidene)-3-sulfamoylbenzamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H9ClN4O3S.ClH/c9-5-2-1-4(7(14)13-8(10)11)3-6(5)17(12,15)16;/h1-3H,(H2,12,15,16)(H4,10,11,13,14);1H |
| InChIKey | UINYVVAXQDKUNQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|