C8H12Cl3N5O3S — CID 22376922
2-amino-4-chloro-N-(diaminomethylidene)-5-sulfamoylbenzamide;dihydrochloride (PubChem CID 22376922) has the molecular formula C8H12Cl3N5O3S and a molecular weight of 364.64 g/mol. Its IUPAC name is 2-amino-4-chloro-N-(diaminomethylidene)-5-sulfamoylbenzamide;dihydrochloride.
| Compound Name | 2-amino-4-chloro-N-(diaminomethylidene)-5-sulfamoylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 22376922 |
| Molecular Formula | C8H12Cl3N5O3S |
| Molecular Weight | 364.64 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 2-amino-4-chloro-N-(diaminomethylidene)-5-sulfamoylbenzamide;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1N |
| InChI | InChI=1S/C8H10ClN5O3S.2ClH/c9-4-2-5(10)3(7(15)14-8(11)12)1-6(4)18(13,16)17;;/h1-2H,10H2,(H2,13,16,17)(H4,11,12,14,15);2*1H |
| InChIKey | JSDZOPANOMFIDY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 167.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.64 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|