C8H7ClIN3O2 — CID 22446949
2-chloro-N-(diaminomethylidene)-4-hydroxy-5-iodobenzamide (PubChem CID 22446949) has the molecular formula C8H7ClIN3O2 and a molecular weight of 339.52 g/mol. Its IUPAC name is 2-chloro-N-(diaminomethylidene)-4-hydroxy-5-iodobenzamide.
| Compound Name | 2-chloro-N-(diaminomethylidene)-4-hydroxy-5-iodobenzamide |
|---|---|
| PubChem CID | 22446949 |
| Molecular Formula | C8H7ClIN3O2 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | 2-chloro-N-(diaminomethylidene)-4-hydroxy-5-iodobenzamide |
| SMILES | NC(N)=NC(=O)c1cc(I)c(O)cc1Cl |
| InChI | InChI=1S/C8H7ClIN3O2/c9-4-2-6(14)5(10)1-3(4)7(15)13-8(11)12/h1-2,14H,(H4,11,12,13,15) |
| InChIKey | KZHGSJZCESNQQB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|