C10H9ClF3N3O2 — CID 18925745
4-chloro-N-(diaminomethylidene)-2-methyl-5-(trifluoromethoxy)benzamide (PubChem CID 18925745) has the molecular formula C10H9ClF3N3O2 and a molecular weight of 295.65 g/mol. Its IUPAC name is 4-chloro-N-(diaminomethylidene)-2-methyl-5-(trifluoromethoxy)benzamide.
| Compound Name | 4-chloro-N-(diaminomethylidene)-2-methyl-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 18925745 |
| Molecular Formula | C10H9ClF3N3O2 |
| Molecular Weight | 295.65 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 4-chloro-N-(diaminomethylidene)-2-methyl-5-(trifluoromethoxy)benzamide |
| SMILES | Cc1cc(Cl)c(OC(F)(F)F)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C10H9ClF3N3O2/c1-4-2-6(11)7(19-10(12,13)14)3-5(4)8(18)17-9(15)16/h2-3H,1H3,(H4,15,16,17,18) |
| InChIKey | XWYCGKIHKFEADW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.65 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|