C10H7BrClF6N3O3 — CID 162161062
4-bromo-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;hydrochloride (PubChem CID 162161062) has the molecular formula C10H7BrClF6N3O3 and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-bromo-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;hydrochloride.
| Compound Name | 4-bromo-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;hydrochloride |
|---|---|
| PubChem CID | 162161062 |
| Molecular Formula | C10H7BrClF6N3O3 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 444.93 |
| IUPAC Name | 4-bromo-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1cc(OC(F)(F)F)c(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C10H6BrF6N3O3.ClH/c11-4-2-5(22-9(12,13)14)3(7(21)20-8(18)19)1-6(4)23-10(15,16)17;/h1-2H,(H4,18,19,20,21);1H |
| InChIKey | AZXIOIGEFSMQQV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|