C22H11F12N5O7 — CID 18925673
4-cyano-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;methyl 4-cyano-2,5-bis(trifluoromethoxy)benzoate (PubChem CID 18925673) has the molecular formula C22H11F12N5O7 and a molecular weight of 685.33 g/mol. Its IUPAC name is 4-cyano-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;methyl 4-cyano-2,5-bis(trifluoromethoxy)benzoate.
| Compound Name | 4-cyano-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;methyl 4-cyano-2,5-bis(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 18925673 |
| Molecular Formula | C22H11F12N5O7 |
| Molecular Weight | 685.33 g/mol |
| Exact Mass | 685.05 |
| IUPAC Name | 4-cyano-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;methyl 4-cyano-2,5-bis(trifluoromethoxy)benzoate |
| SMILES | COC(=O)c1cc(OC(F)(F)F)c(C#N)cc1OC(F)(F)F.N#Cc1cc(OC(F)(F)F)c(C(=O)N=C(N)N)cc1OC(F)(F)F |
| InChI | InChI=1S/C11H6F6N4O3.C11H5F6NO4/c12-10(13,14)23-6-2-5(8(22)21-9(19)20)7(1-4(6)3-18)24-11(15,16)17;1-20-9(19)6-3-7(21-10(12,13)14)5(4-18)2-8(6)22-11(15,16)17/h1-2H,(H4,19,20,21,22);2-3H,1H3 |
| InChIKey | SMVVBCZYCSYVJR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 192.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|