C22H23F6N3O5 — CID 18925655
N-(diaminomethylidene)-2-ethyl-5-(trifluoromethoxy)benzamide;methyl 2-ethyl-5-(trifluoromethoxy)benzoate (PubChem CID 18925655) has the molecular formula C22H23F6N3O5 and a molecular weight of 523.43 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-ethyl-5-(trifluoromethoxy)benzamide;methyl 2-ethyl-5-(trifluoromethoxy)benzoate.
| Compound Name | N-(diaminomethylidene)-2-ethyl-5-(trifluoromethoxy)benzamide;methyl 2-ethyl-5-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 18925655 |
| Molecular Formula | C22H23F6N3O5 |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | N-(diaminomethylidene)-2-ethyl-5-(trifluoromethoxy)benzamide;methyl 2-ethyl-5-(trifluoromethoxy)benzoate |
| SMILES | CCc1ccc(OC(F)(F)F)cc1C(=O)N=C(N)N.CCc1ccc(OC(F)(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C11H12F3N3O2.C11H11F3O3/c1-2-6-3-4-7(19-11(12,13)14)5-8(6)9(18)17-10(15)16;1-3-7-4-5-8(17-11(12,13)14)6-9(7)10(15)16-2/h3-5H,2H2,1H3,(H4,15,16,17,18);4-6H,3H2,1-2H3 |
| InChIKey | XNQBNFBLFJLMRW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|