C20H11Br2F12N3O7 — CID 18925670
4-bromo-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;methyl 4-bromo-2,5-bis(trifluoromethoxy)benzoate (PubChem CID 18925670) has the molecular formula C20H11Br2F12N3O7 and a molecular weight of 793.11 g/mol. Its IUPAC name is 4-bromo-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;methyl 4-bromo-2,5-bis(trifluoromethoxy)benzoate.
| Compound Name | 4-bromo-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;methyl 4-bromo-2,5-bis(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 18925670 |
| Molecular Formula | C20H11Br2F12N3O7 |
| Molecular Weight | 793.11 g/mol |
| Exact Mass | 790.88 |
| IUPAC Name | 4-bromo-N-(diaminomethylidene)-2,5-bis(trifluoromethoxy)benzamide;methyl 4-bromo-2,5-bis(trifluoromethoxy)benzoate |
| SMILES | COC(=O)c1cc(OC(F)(F)F)c(Br)cc1OC(F)(F)F.NC(N)=NC(=O)c1cc(OC(F)(F)F)c(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C10H6BrF6N3O3.C10H5BrF6O4/c11-4-2-5(22-9(12,13)14)3(7(21)20-8(18)19)1-6(4)23-10(15,16)17;1-19-8(18)4-2-7(21-10(15,16)17)5(11)3-6(4)20-9(12,13)14/h1-2H,(H4,18,19,20,21);2-3H,1H3 |
| InChIKey | OPELBQHFGQDUCI-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.11 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|