C7H6BrF3N2O — CID 26985379
4-bromo-5-(trifluoromethoxy)benzene-1,2-diamine (PubChem CID 26985379) has the molecular formula C7H6BrF3N2O and a molecular weight of 271.04 g/mol. Its IUPAC name is 4-bromo-5-(trifluoromethoxy)benzene-1,2-diamine.
| Compound Name | 4-bromo-5-(trifluoromethoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 26985379 |
| Molecular Formula | C7H6BrF3N2O |
| Molecular Weight | 271.04 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | 4-bromo-5-(trifluoromethoxy)benzene-1,2-diamine |
| SMILES | Nc1cc(Br)c(OC(F)(F)F)cc1N |
| InChI | InChI=1S/C7H6BrF3N2O/c8-3-1-4(12)5(13)2-6(3)14-7(9,10)11/h1-2H,12-13H2 |
| InChIKey | KGYPCBHVYVIFFM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.04 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|