C7H3Br3F3NO — CID 171368143
2,3,4-tribromo-6-(trifluoromethoxy)aniline (PubChem CID 171368143) has the molecular formula C7H3Br3F3NO and a molecular weight of 413.81 g/mol. Its IUPAC name is 2,3,4-tribromo-6-(trifluoromethoxy)aniline.
| Compound Name | 2,3,4-tribromo-6-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 171368143 |
| Molecular Formula | C7H3Br3F3NO |
| Molecular Weight | 413.81 g/mol |
| Exact Mass | 410.77 |
| IUPAC Name | 2,3,4-tribromo-6-(trifluoromethoxy)aniline |
| SMILES | Nc1c(OC(F)(F)F)cc(Br)c(Br)c1Br |
| InChI | InChI=1S/C7H3Br3F3NO/c8-2-1-3(15-7(11,12)13)6(14)5(10)4(2)9/h1H,14H2 |
| InChIKey | IKCVOIVMFZFWSX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|