About 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene
1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene (PubChem CID 121228033) has the molecular formula C7HBr2F5O
and a molecular weight of 355.88 g/mol. Its IUPAC name is 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene.
Molecular Properties
| Compound Name | 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene |
| PubChem CID | 121228033 |
| Molecular Formula | C7HBr2F5O |
| Molecular Weight | 355.88 g/mol |
| Exact Mass | 353.83 |
| IUPAC Name | 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene |
| SMILES | Fc1c(Br)cc(OC(F)(F)F)c(Br)c1F |
| InChI | InChI=1S/C7HBr2F5O/c8-2-1-3(15-7(12,13)14)4(9)6(11)5(2)10/h1H |
| InChIKey | YNPFAQUBFSUVQN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene?
The IUPAC name of 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene (CID 121228033) is 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene.
What is the SMILES notation for 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene?
The canonical SMILES for 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene is Fc1c(Br)cc(OC(F)(F)F)c(Br)c1F.
What is the InChIKey of 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene?
The InChIKey is YNPFAQUBFSUVQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7HBr2F5O/c8-2-1-3(15-7(12,13)14)4(9)6(11)5(2)10/h1H.
What are the key properties of 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene?
1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene has a molecular weight of 355.88 g/mol, XLogP of 4.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibromo-2,3-difluoro-5-(trifluoromethoxy)benzene is sourced from PubChem (CID 121228033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).