C7HBr2F5S — CID 134615622
1,4-dibromo-2,3-difluoro-5-(trifluoromethylsulfanyl)benzene (PubChem CID 134615622) has the molecular formula C7HBr2F5S and a molecular weight of 371.95 g/mol. Its IUPAC name is 1,4-dibromo-2,3-difluoro-5-(trifluoromethylsulfanyl)benzene.
| Compound Name | 1,4-dibromo-2,3-difluoro-5-(trifluoromethylsulfanyl)benzene |
|---|---|
| PubChem CID | 134615622 |
| Molecular Formula | C7HBr2F5S |
| Molecular Weight | 371.95 g/mol |
| Exact Mass | 369.81 |
| IUPAC Name | 1,4-dibromo-2,3-difluoro-5-(trifluoromethylsulfanyl)benzene |
| SMILES | Fc1c(Br)cc(SC(F)(F)F)c(Br)c1F |
| InChI | InChI=1S/C7HBr2F5S/c8-2-1-3(15-7(12,13)14)4(9)6(11)5(2)10/h1H |
| InChIKey | JGNHAMZQAXDNJD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|