C7HBr2F5O — CID 118807728
1,5-dibromo-2,3-difluoro-4-(trifluoromethoxy)benzene (PubChem CID 118807728) has the molecular formula C7HBr2F5O and a molecular weight of 355.88 g/mol. Its IUPAC name is 1,5-dibromo-2,3-difluoro-4-(trifluoromethoxy)benzene.
| Compound Name | 1,5-dibromo-2,3-difluoro-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 118807728 |
| Molecular Formula | C7HBr2F5O |
| Molecular Weight | 355.88 g/mol |
| Exact Mass | 353.83 |
| IUPAC Name | 1,5-dibromo-2,3-difluoro-4-(trifluoromethoxy)benzene |
| SMILES | Fc1c(Br)cc(Br)c(OC(F)(F)F)c1F |
| InChI | InChI=1S/C7HBr2F5O/c8-2-1-3(9)6(5(11)4(2)10)15-7(12,13)14/h1H |
| InChIKey | BOMAMCQGADKNFD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|