C6H2Br2F3NO2 — CID 119010745
4,6-dibromo-5-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 119010745) has the molecular formula C6H2Br2F3NO2 and a molecular weight of 336.89 g/mol. Its IUPAC name is 4,6-dibromo-5-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 4,6-dibromo-5-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 119010745 |
| Molecular Formula | C6H2Br2F3NO2 |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 334.84 |
| IUPAC Name | 4,6-dibromo-5-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | O=c1cc(Br)c(OC(F)(F)F)c(Br)[nH]1 |
| InChI | InChI=1S/C6H2Br2F3NO2/c7-2-1-3(13)12-5(8)4(2)14-6(9,10)11/h1H,(H,12,13) |
| InChIKey | GOJJBYSREOOXKQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|