C8H5F4NO3 — CID 118811740
4-(fluoromethyl)-6-oxo-3-(trifluoromethoxy)-1H-pyridine-2-carbaldehyde (PubChem CID 118811740) has the molecular formula C8H5F4NO3 and a molecular weight of 239.12 g/mol. Its IUPAC name is 4-(fluoromethyl)-6-oxo-3-(trifluoromethoxy)-1H-pyridine-2-carbaldehyde.
| Compound Name | 4-(fluoromethyl)-6-oxo-3-(trifluoromethoxy)-1H-pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 118811740 |
| Molecular Formula | C8H5F4NO3 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 4-(fluoromethyl)-6-oxo-3-(trifluoromethoxy)-1H-pyridine-2-carbaldehyde |
| SMILES | O=Cc1[nH]c(=O)cc(CF)c1OC(F)(F)F |
| InChI | InChI=1S/C8H5F4NO3/c9-2-4-1-6(15)13-5(3-14)7(4)16-8(10,11)12/h1,3H,2H2,(H,13,15) |
| InChIKey | BVMMIBZOSDEHBC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|