C7H4F4INO2 — CID 134665423
5-(fluoromethyl)-3-iodo-6-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 134665423) has the molecular formula C7H4F4INO2 and a molecular weight of 337.01 g/mol. Its IUPAC name is 5-(fluoromethyl)-3-iodo-6-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 5-(fluoromethyl)-3-iodo-6-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134665423 |
| Molecular Formula | C7H4F4INO2 |
| Molecular Weight | 337.01 g/mol |
| Exact Mass | 336.92 |
| IUPAC Name | 5-(fluoromethyl)-3-iodo-6-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(OC(F)(F)F)c(CF)cc1I |
| InChI | InChI=1S/C7H4F4INO2/c8-2-3-1-4(12)5(14)13-6(3)15-7(9,10)11/h1H,2H2,(H,13,14) |
| InChIKey | JEWWCEJOFWRLRS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.01 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|