C9H6ClF3N2O2 — CID 134666130
2-[5-(chloromethyl)-6-oxo-2-(trifluoromethoxy)-1H-pyridin-3-yl]acetonitrile (PubChem CID 134666130) has the molecular formula C9H6ClF3N2O2 and a molecular weight of 266.61 g/mol. Its IUPAC name is 2-[5-(chloromethyl)-6-oxo-2-(trifluoromethoxy)-1H-pyridin-3-yl]acetonitrile.
| Compound Name | 2-[5-(chloromethyl)-6-oxo-2-(trifluoromethoxy)-1H-pyridin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 134666130 |
| Molecular Formula | C9H6ClF3N2O2 |
| Molecular Weight | 266.61 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-[5-(chloromethyl)-6-oxo-2-(trifluoromethoxy)-1H-pyridin-3-yl]acetonitrile |
| SMILES | N#CCc1cc(CCl)c(=O)[nH]c1OC(F)(F)F |
| InChI | InChI=1S/C9H6ClF3N2O2/c10-4-6-3-5(1-2-14)8(15-7(6)16)17-9(11,12)13/h3H,1,4H2,(H,15,16) |
| InChIKey | VMNMHYKUYBIFSJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.61 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|