C9H8F3N3O2 — CID 134666956
2-[5-(aminomethyl)-6-oxo-3-(trifluoromethoxy)-1H-pyridin-2-yl]acetonitrile (PubChem CID 134666956) has the molecular formula C9H8F3N3O2 and a molecular weight of 247.18 g/mol. Its IUPAC name is 2-[5-(aminomethyl)-6-oxo-3-(trifluoromethoxy)-1H-pyridin-2-yl]acetonitrile.
| Compound Name | 2-[5-(aminomethyl)-6-oxo-3-(trifluoromethoxy)-1H-pyridin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 134666956 |
| Molecular Formula | C9H8F3N3O2 |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-[5-(aminomethyl)-6-oxo-3-(trifluoromethoxy)-1H-pyridin-2-yl]acetonitrile |
| SMILES | N#CCc1[nH]c(=O)c(CN)cc1OC(F)(F)F |
| InChI | InChI=1S/C9H8F3N3O2/c10-9(11,12)17-7-3-5(4-14)8(16)15-6(7)1-2-13/h3H,1,4,14H2,(H,15,16) |
| InChIKey | OYNQMVWFMPCVDZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |