C8H6F6N2O2 — CID 134664492
3-(aminomethyl)-5-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 134664492) has the molecular formula C8H6F6N2O2 and a molecular weight of 276.14 g/mol. Its IUPAC name is 3-(aminomethyl)-5-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-(aminomethyl)-5-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134664492 |
| Molecular Formula | C8H6F6N2O2 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 3-(aminomethyl)-5-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | NCc1cc(OC(F)(F)F)c(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C8H6F6N2O2/c9-7(10,11)5-4(18-8(12,13)14)1-3(2-15)6(17)16-5/h1H,2,15H2,(H,16,17) |
| InChIKey | FMBRZSZJCQQTIG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |